EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | COc1cc(C=O)cc(OC)c1O |
| InChI | InChI=1S/C9H10O4/c1-12-7-3-6(5-10)4-8(13-2)9(7)11/h3-5,11H,1-2H3 |
| InChIKey | KCDXJAYRVLXPFO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Panax japonicus var. major (ncbitaxon:45211) | root (BTO:0001188) | PubMed (21417387) | Ethanolic extract of dried and pulverized roots |
| Pisonia aculeata (ncbitaxon:363212) | |||
| stem (BTO:0001300) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| root (BTO:0001188) | PubMed (21542597) | Cold methanolic extract of dried stems and roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| syringaldehyde (CHEBI:67380) has role hypoglycemic agent (CHEBI:35526) |
| syringaldehyde (CHEBI:67380) has role plant metabolite (CHEBI:76924) |
| syringaldehyde (CHEBI:67380) is a dimethoxybenzene (CHEBI:51681) |
| syringaldehyde (CHEBI:67380) is a hydroxybenzaldehyde (CHEBI:24673) |
| Incoming Relation(s) |
| syringaldehyde acetate (CHEBI:86945) has functional parent syringaldehyde (CHEBI:67380) |
| IUPAC Name |
|---|
| 4-hydroxy-3,5-dimethoxybenzaldehyde |
| Manual Xrefs | Databases |
|---|---|
| RU94026845 | Patent |
| Syringaldehyde | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:784514 | Reaxys |
| CAS:134-96-3 | ChemIDplus |
| Citations |
|---|