EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O5 |
| Net Charge | 0 |
| Average Mass | 298.294 |
| Monoisotopic Mass | 298.08412 |
| SMILES | Cc1c(O)c(C)c2occ(-c3ccccc3O)c(=O)c2c1O |
| InChI | InChI=1S/C17H14O5/c1-8-14(19)9(2)17-13(15(8)20)16(21)11(7-22-17)10-5-3-4-6-12(10)18/h3-7,18-20H,1-2H3 |
| InChIKey | VYFQDBFEAYEXCL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pisonia aculeata (ncbitaxon:363212) | |||
| stem (BTO:0001300) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| root (BTO:0001188) | PubMed (21542597) | Cold methanolic extract of dried stems and roots |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,8-dimethylisogenistein (CHEBI:67377) has role metabolite (CHEBI:25212) |
| 6,8-dimethylisogenistein (CHEBI:67377) has role plant metabolite (CHEBI:76924) |
| 6,8-dimethylisogenistein (CHEBI:67377) is a 2'-hydroxyisoflavones (CHEBI:28206) |
| 6,8-dimethylisogenistein (CHEBI:67377) is a 7-hydroxyisoflavones (CHEBI:55465) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-(2-hydroxyphenyl)-6,8-dimethyl-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 5,7,2'-trihydroxy-6,8-dimethylisoflavone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22255185 | Reaxys |
| Citations |
|---|