EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10O4 |
| Net Charge | 0 |
| Average Mass | 206.197 |
| Monoisotopic Mass | 206.05791 |
| SMILES | COc1cc(O)c2c(=O)cc(C)oc2c1 |
| InChI | InChI=1S/C11H10O4/c1-6-3-8(12)11-9(13)4-7(14-2)5-10(11)15-6/h3-5,13H,1-2H3 |
| InChIKey | SUTUBQHKZRNZRA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pisonia aculeata (ncbitaxon:363212) | |||
| root (BTO:0001188) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| stem (BTO:0001300) | PubMed (21542597) | Cold methanolic extract of dried stems and roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eugenin (CHEBI:67374) has functional parent chromone (CHEBI:72013) |
| eugenin (CHEBI:67374) has role plant metabolite (CHEBI:76924) |
| eugenin (CHEBI:67374) is a aromatic ether (CHEBI:35618) |
| eugenin (CHEBI:67374) is a chromones (CHEBI:23238) |
| eugenin (CHEBI:67374) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 5-hydroxy-7-methoxy-2-methyl-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5-Hydroxy-7-methoxy-2-methylchromone | ChEBI |
| 5-hydroxy-7-methoxy-2-methylchromen-4-one | ChEBI |
| 5-hydroxy-7-methoxy-2-methyl-4H-1-benzopyran-4-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Eugenin | Wikipedia |
| HMDB0036627 | HMDB |
| C20210 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:170143 | Reaxys |
| CAS:480-34-2 | ChemIDplus |
| Citations |
|---|