EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O6 |
| Net Charge | 0 |
| Average Mass | 314.293 |
| Monoisotopic Mass | 314.07904 |
| SMILES | COc1c2c(cc3c1C(=O)[C@H](O)[C@@H](c1ccccc1)O3)OCO2 |
| InChI | InChI=1S/C17H14O6/c1-20-17-12-10(7-11-16(17)22-8-21-11)23-15(14(19)13(12)18)9-5-3-2-4-6-9/h2-7,14-15,19H,8H2,1H3/t14-,15+/m0/s1 |
| InChIKey | MJAIKSJQFBNFDU-LSDHHAIUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pisonia aculeata (ncbitaxon:363212) | |||
| stem (BTO:0001300) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| root (BTO:0001188) | PubMed (21542597) | Cold methanolic extract of dried stems and roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3R)-3-hydroxy-5-methoxy-6,7- methylenedioxyflavanone (CHEBI:67372) has role plant metabolite (CHEBI:76924) |
| (2R,3R)-3-hydroxy-5-methoxy-6,7- methylenedioxyflavanone (CHEBI:67372) is a dihydroflavonols (CHEBI:48039) |
| (2R,3R)-3-hydroxy-5-methoxy-6,7- methylenedioxyflavanone (CHEBI:67372) is a extended flavonoid (CHEBI:71037) |
| (2R,3R)-3-hydroxy-5-methoxy-6,7- methylenedioxyflavanone (CHEBI:67372) is a monomethoxyflavanone (CHEBI:38738) |
| (2R,3R)-3-hydroxy-5-methoxy-6,7- methylenedioxyflavanone (CHEBI:67372) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (6R,7R)-7-hydroxy-9-methoxy-6-phenyl-6,7-dihydro-8H-[1,3]dioxolo[4,5-g]chromen-8-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5605978 | Reaxys |
| Citations |
|---|