EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO2 |
| Net Charge | 0 |
| Average Mass | 281.355 |
| Monoisotopic Mass | 281.14158 |
| SMILES | COc1ccc(CCNC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19NO2/c1-21-17-10-7-16(8-11-17)13-14-19-18(20)12-9-15-5-3-2-4-6-15/h2-12H,13-14H2,1H3,(H,19,20)/b12-9+ |
| InChIKey | CHPUDVNXYIZPKX-FMIVXFBMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pisonia aculeata (ncbitaxon:363212) | |||
| stem (BTO:0001300) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| root (BTO:0001188) | PubMed (21542597) | Cold methanolic extract of dried stems and roots |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pisoniamide (CHEBI:67367) has functional parent trans-cinnamamide (CHEBI:76320) |
| pisoniamide (CHEBI:67367) has role metabolite (CHEBI:25212) |
| pisoniamide (CHEBI:67367) has role plant metabolite (CHEBI:76924) |
| pisoniamide (CHEBI:67367) is a cinnamamides (CHEBI:23247) |
| pisoniamide (CHEBI:67367) is a monomethoxybenzene (CHEBI:25235) |
| pisoniamide (CHEBI:67367) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (2E)-N-[2-(4-methoxyphenyl)ethyl]-3-phenylprop-2-enamide |
| Synonyms | Source |
|---|---|
| N-[2-(4-methoxyphenyl)ethyl]-3-phenylacrylamide | ChEBI |
| N-(4-methoxyphenethyl)cinnamamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9563365 | Reaxys |
| Citations |
|---|