EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O6 |
| Net Charge | 0 |
| Average Mass | 316.309 |
| Monoisotopic Mass | 316.09469 |
| SMILES | COc1c(O)cc2c(c1OC)C(=O)[C@H](O)[C@@H](c1ccccc1)O2 |
| InChI | InChI=1S/C17H16O6/c1-21-16-10(18)8-11-12(17(16)22-2)13(19)14(20)15(23-11)9-6-4-3-5-7-9/h3-8,14-15,18,20H,1-2H3/t14-,15+/m0/s1 |
| InChIKey | HERMXACAVKAURU-LSDHHAIUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pisonia aculeata (ncbitaxon:363212) | |||
| stem (BTO:0001300) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| root (BTO:0001188) | PubMed (21542597) | Cold methanolic extract of dried stems and roots |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pisonivanol (CHEBI:67365) has functional parent (2S)-flavanone (CHEBI:15606) |
| pisonivanol (CHEBI:67365) has role metabolite (CHEBI:25212) |
| pisonivanol (CHEBI:67365) has role plant metabolite (CHEBI:76924) |
| pisonivanol (CHEBI:67365) is a dihydroflavonols (CHEBI:48039) |
| pisonivanol (CHEBI:67365) is a dihydroxyflavanone (CHEBI:38749) |
| pisonivanol (CHEBI:67365) is a dimethoxyflavanone (CHEBI:38743) |
| pisonivanol (CHEBI:67365) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (2R,3R)-3,7-dihydroxy-5,6-dimethoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| (2R,3R)-3,7-dihydroxy-5,6-dimethoxyflavanone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559748 | Reaxys |
| Citations |
|---|