EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6O5 |
| Net Charge | 0 |
| Average Mass | 206.153 |
| Monoisotopic Mass | 206.02152 |
| SMILES | O=c1ccoc2cc3c(c(O)c12)OCO3 |
| InChI | InChI=1S/C10H6O5/c11-5-1-2-13-6-3-7-10(15-4-14-7)9(12)8(5)6/h1-3,12H,4H2 |
| InChIKey | AHAIEGDZOQITKC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pisonia aculeata (ncbitaxon:363212) | |||
| root (BTO:0001188) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| stem (BTO:0001300) | PubMed (21542597) | Cold methanolic extract of dried stems and roots |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pisonin D (CHEBI:67361) has role metabolite (CHEBI:25212) |
| pisonin D (CHEBI:67361) has role plant metabolite (CHEBI:76924) |
| pisonin D (CHEBI:67361) is a chromones (CHEBI:23238) |
| pisonin D (CHEBI:67361) is a organic heterotricyclic compound (CHEBI:26979) |
| pisonin D (CHEBI:67361) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 9-hydroxy-8H-[1,3]dioxolo[4,5-g]chromen-8-one |
| Synonym | Source |
|---|---|
| 5-hydroxy-6,7-methylenedioxychromone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559747 | Reaxys |
| Citations |
|---|