EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30O11 |
| Net Charge | 0 |
| Average Mass | 506.504 |
| Monoisotopic Mass | 506.17881 |
| SMILES | [H][C@@]1(O[C@@H]2OC=C(C(=O)O)[C@@]3([H])CC[C@](C)(OC(=O)/C=C/c4ccccc4)[C@@]23[H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H30O11/c1-25(36-17(27)8-7-13-5-3-2-4-6-13)10-9-14-15(22(31)32)12-33-23(18(14)25)35-24-21(30)20(29)19(28)16(11-26)34-24/h2-8,12,14,16,18-21,23-24,26,28-30H,9-11H2,1H3,(H,31,32)/b8-7+/t14-,16-,18-,19-,20+,21-,23+,24+,25+/m1/s1 |
| InChIKey | SKMCYGKNAPIRGG-GKBUEBNRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anarrhinum orientale (IPNI:798907-1) | aerial part (BTO:0001658) | PubMed (21506603) | MeOH extract of dried aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-O-cinnamoylmussaenosidic acid (CHEBI:67352) has role metabolite (CHEBI:25212) |
| 8-O-cinnamoylmussaenosidic acid (CHEBI:67352) is a terpene glycoside (CHEBI:61777) |
| Synonym | Source |
|---|---|
| (1S,4aS,7S,7aS)-1-(beta-D-Glucopyranosyloxy)-7-methyl-7-{[(2E)-3-phenyl-2-propenoyl]oxy}-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid | ChEBI |
| Citations |
|---|