EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | C/C(=C\CO)CC/C=C(\C)C(=O)OC/C=C(\C)CC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C20H30O5/c1-15(11-13-21)7-6-10-18(4)20(24)25-14-12-16(2)8-5-9-17(3)19(22)23/h9-12,21H,5-8,13-14H2,1-4H3,(H,22,23)/b15-11+,16-12+,17-9+,18-10+ |
| InChIKey | QOEZNNVCUUKXPK-KXXJHGMOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anarrhinum orientale (IPNI:798907-1) | aerial part (BTO:0001658) | PubMed (21506603) | MeOH extract of dried aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,6E)-8-{[(2E,6E)-8-hydroxy-2,6-dimethylocta-2,6-dienoyl]oxy}-2,6-dimethylocta-2,6-dienoic acid (CHEBI:67350) has role metabolite (CHEBI:25212) |
| (2E,6E)-8-{[(2E,6E)-8-hydroxy-2,6-dimethylocta-2,6-dienoyl]oxy}-2,6-dimethylocta-2,6-dienoic acid (CHEBI:67350) is a monoterpenoid (CHEBI:25409) |
| Citations |
|---|