EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30O11 |
| Net Charge | 0 |
| Average Mass | 506.504 |
| Monoisotopic Mass | 506.17881 |
| SMILES | [H][C@@]1(O[C@@H]2OC=C(C(=O)O)[C@]3([H])CC[C@@](C)(O)[C@]23[H])O[C@H](COC(=O)/C=C/c2ccccc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H30O11/c1-25(32)10-9-14-15(22(30)31)11-34-23(18(14)25)36-24-21(29)20(28)19(27)16(35-24)12-33-17(26)8-7-13-5-3-2-4-6-13/h2-8,11,14,16,18-21,23-24,27-29,32H,9-10,12H2,1H3,(H,30,31)/b8-7+/t14-,16+,18-,19+,20-,21+,23-,24-,25+/m0/s1 |
| InChIKey | YXCPQONSMLKCHP-ZRSLISBWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anarrhinum orientale (IPNI:798907-1) | aerial part (BTO:0001658) | PubMed (21506603) | MeOH extract of dried aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6'-O-cinnamoylmussaenosidic acid, (rel)- (CHEBI:67348) has role metabolite (CHEBI:25212) |
| 6'-O-cinnamoylmussaenosidic acid, (rel)- (CHEBI:67348) is a terpene glycoside (CHEBI:61777) |
| Citations |
|---|