EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O3 |
| Net Charge | 0 |
| Average Mass | 254.370 |
| Monoisotopic Mass | 254.18819 |
| SMILES | [H][C@]12C(=C)CC[C@@H](O)[C@]1(C)CC[C@@](O)(C(C)C)[C@@H]2O |
| InChI | InChI=1S/C15H26O3/c1-9(2)15(18)8-7-14(4)11(16)6-5-10(3)12(14)13(15)17/h9,11-13,16-18H,3,5-8H2,1-2,4H3/t11-,12-,13-,14+,15-/m1/s1 |
| InChIKey | CUHWMIOLJCBKOH-ARILJUKYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tephrosia candida (IPNI:520444-1) | aerial part (BTO:0001658) | PubMed (21510635) | CH2Cl2-MeOH (1:1) extract of crushed, air-dried aerial parts |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1β-hydroxy-6,7α-dihydroxyeudesm-4(15)-ene (CHEBI:67346) has role plant metabolite (CHEBI:76924) |
| 1β-hydroxy-6,7α-dihydroxyeudesm-4(15)-ene (CHEBI:67346) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| 1β-hydroxy-6,7α-dihydroxyeudesm-4(15)-ene (CHEBI:67346) is a secondary alcohol (CHEBI:35681) |
| 1β-hydroxy-6,7α-dihydroxyeudesm-4(15)-ene (CHEBI:67346) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| rel-(1R,2R,4aR,5R,8aS)-4a-methyl-8-methylidene-2-(propan-2-yl)decahydronaphthalene-1,2,5-triol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534250 | Reaxys |
| Citations |
|---|