EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O6 |
| Net Charge | 0 |
| Average Mass | 370.401 |
| Monoisotopic Mass | 370.14164 |
| SMILES | COc1cc(O)c(/C=C\C(C)(C)O)c(O)c1C(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C21H22O6/c1-21(2,26)11-10-15-17(24)12-18(27-3)19(20(15)25)16(23)9-6-13-4-7-14(22)8-5-13/h4-12,22,24-26H,1-3H3/b9-6+,11-10- |
| InChIKey | KOWOOXVTWKELMT-RQDFUGDESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tephrosia candida (IPNI:520444-1) | aerial part (BTO:0001658) | PubMed (21510635) | CH2Cl2-MeOH (1:1) extract of crushed, air-dried aerial parts |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| candidachalcone (CHEBI:67345) has functional parent trans-chalcone (CHEBI:48965) |
| candidachalcone (CHEBI:67345) has role metabolite (CHEBI:25212) |
| candidachalcone (CHEBI:67345) has role plant metabolite (CHEBI:76924) |
| candidachalcone (CHEBI:67345) is a chalcones (CHEBI:23086) |
| candidachalcone (CHEBI:67345) is a monomethoxybenzene (CHEBI:25235) |
| candidachalcone (CHEBI:67345) is a resorcinols (CHEBI:33572) |
| candidachalcone (CHEBI:67345) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2E)-1-{2,4-dihydroxy-3-[(1Z)-3-hydroxy-3-methylbut-1-en-1-yl]-6-methoxyphenyl}-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534249 | Reaxys |
| Citations |
|---|