EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O6 |
| Net Charge | 0 |
| Average Mass | 370.401 |
| Monoisotopic Mass | 370.14164 |
| SMILES | COc1cc(O)c(/C=C\C(C)(C)O)c(O)c1C(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C21H22O6/c1-21(2,26)11-10-15-17(24)12-18(27-3)19(20(15)25)16(23)9-6-13-4-7-14(22)8-5-13/h4-12,22,24-26H,1-3H3/b9-6+,11-10- |
| InChIKey | KOWOOXVTWKELMT-RQDFUGDESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tephrosia candida (IPNI:520444-1) | aerial part (BTO:0001658) | PubMed (21510635) | CH2Cl2-MeOH (1:1) extract of crushed, air-dried aerial parts |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| candidachalcone (CHEBI:67345) has functional parent trans-chalcone (CHEBI:48965) |
| candidachalcone (CHEBI:67345) has role metabolite (CHEBI:25212) |
| candidachalcone (CHEBI:67345) has role plant metabolite (CHEBI:76924) |
| candidachalcone (CHEBI:67345) is a chalcones (CHEBI:23086) |
| candidachalcone (CHEBI:67345) is a monomethoxybenzene (CHEBI:25235) |
| candidachalcone (CHEBI:67345) is a resorcinols (CHEBI:33572) |
| candidachalcone (CHEBI:67345) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2E)-1-{2,4-dihydroxy-3-[(1Z)-3-hydroxy-3-methylbut-1-en-1-yl]-6-methoxyphenyl}-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534249 | Reaxys |
| Citations |
|---|