EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H63BrN4O9 |
| Net Charge | 0 |
| Average Mass | 799.845 |
| Monoisotopic Mass | 798.37784 |
| SMILES | CCOC(=O)[C@H](C(C)C)N(C)C(=O)[C@@H]1CCCN1C(=O)[C@@H](OC(=O)[C@H](C(C)C)N(C)C(=O)[C@@H](NC(=O)[C@@H](C)[C@H](O)CCCC#CBr)C(C)C)C(C)C |
| InChI | InChI=1S/C38H63BrN4O9/c1-13-51-37(49)30(23(4)5)41(11)34(46)27-18-17-21-43(27)36(48)32(25(8)9)52-38(50)31(24(6)7)42(12)35(47)29(22(2)3)40-33(45)26(10)28(44)19-15-14-16-20-39/h22-32,44H,13-15,17-19,21H2,1-12H3,(H,40,45)/t26-,27-,28+,29-,30-,31-,32-/m0/s1 |
| InChIKey | XFJWITCKHVUBEG-OPSDFPEKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoria margaritifera PAC-17-FEB-10-2 (ncbitaxon:991921) | - | PubMed (21488639) | CH2Cl2:CH3OH(2:1) extract of biomass |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Veraguamide L (CHEBI:67342) has role metabolite (CHEBI:25212) |
| Veraguamide L (CHEBI:67342) is a depsipeptide (CHEBI:23643) |
| Citations |
|---|