EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H65BrN4O9 |
| Net Charge | 0 |
| Average Mass | 813.872 |
| Monoisotopic Mass | 812.39349 |
| SMILES | CCOC(=O)[C@H](C(C)C)N(C)C(=O)[C@@H]1CCCN1C(=O)[C@@H](OC(=O)[C@H](C(C)C)N(C)C(=O)[C@@H](NC(=O)[C@@H](C)[C@H](O)CCCC#CBr)C(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C39H65BrN4O9/c1-13-26(9)33(37(49)44-22-18-19-28(44)35(47)42(11)31(24(5)6)38(50)52-14-2)53-39(51)32(25(7)8)43(12)36(48)30(23(3)4)41-34(46)27(10)29(45)20-16-15-17-21-40/h23-33,45H,13-16,18-20,22H2,1-12H3,(H,41,46)/t26-,27-,28-,29+,30-,31-,32-,33-/m0/s1 |
| InChIKey | LUHSXKWLOOLDHE-WZBRKTEESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoria margaritifera PAC-17-FEB-10-2 (ncbitaxon:991921) | - | PubMed (21488639) | CH2Cl2:CH3OH(2:1) extract of biomass |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Veraguamide K (CHEBI:67341) has role metabolite (CHEBI:25212) |
| Veraguamide K (CHEBI:67341) is a depsipeptide (CHEBI:23643) |
| Citations |
|---|