EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H57BrN4O8 |
| Net Charge | 0 |
| Average Mass | 753.776 |
| Monoisotopic Mass | 752.33598 |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](C)[C@@H](CCCC#CBr)OC(=O)[C@H](C(C)C)N(C)C(=O)[C@@H]2CCCN2C(=O)[C@H](C(C)C)OC(=O)[C@H](C(C)C)N(C)C1=O |
| InChI | InChI=1S/C36H57BrN4O8/c1-20(2)27-33(44)40(11)29(22(5)6)36(47)49-30(23(7)8)34(45)41-19-15-16-25(41)32(43)39(10)28(21(3)4)35(46)48-26(17-13-12-14-18-37)24(9)31(42)38-27/h20-30H,12-13,15-17,19H2,1-11H3,(H,38,42)/t24-,25-,26+,27-,28-,29-,30-/m0/s1 |
| InChIKey | UQYHDSHIIDYSSP-PYYGQVSISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoria margaritifera PAC-17-FEB-10-2 (ncbitaxon:991921) | - | PubMed (21488639) | CH2Cl2:CH3OH(2:1) extract of biomass |
| Symploca hydnoides (ncbitaxon:207924) | - | PubMed (21446699) | EtOAc-MeOH(1:1) extract of freeze-dried cyanobacteria |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Veraguamide B (CHEBI:67331) has role metabolite (CHEBI:25212) |
| Veraguamide B (CHEBI:67331) is a cyclodepsipeptide (CHEBI:35213) |
| Citations |
|---|