EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10N4O2 |
| Net Charge | 0 |
| Average Mass | 278.271 |
| Monoisotopic Mass | 278.08038 |
| SMILES | O=C1NC(=O)C(c2cnc3ccccc23)=C1c1cncn1 |
| InChI | InChI=1S/C15H10N4O2/c20-14-12(9-5-17-10-4-2-1-3-8(9)10)13(15(21)19-14)11-6-16-7-18-11/h1-7,17H,(H,16,18)(H,19,20,21) |
| InChIKey | HYVUONWSNKUQCE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Didemnum (ncbitaxon:107395) | - | PubMed (21348447) | The freeze dried material was extracted with methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| didemnimide A (CHEBI:67326) has role metabolite (CHEBI:25212) |
| didemnimide A (CHEBI:67326) is a indoles (CHEBI:24828) |
| didemnimide A (CHEBI:67326) is a maleimides (CHEBI:55417) |
| didemnimide A (CHEBI:67326) is a pyrroles (CHEBI:26455) |
| Synonym | Source |
|---|---|
| 3-(1H-Imidazol-5-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dione | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 353257 | ChemSpider |
| Citations |
|---|