EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23BrN4O2 |
| Net Charge | 0 |
| Average Mass | 395.301 |
| Monoisotopic Mass | 394.10044 |
| SMILES | NCCCCNCCCNC(=O)C(=O)c1cnc2cc(Br)ccc12 |
| InChI | InChI=1S/C17H23BrN4O2/c18-12-4-5-13-14(11-22-15(13)10-12)16(23)17(24)21-9-3-8-20-7-2-1-6-19/h4-5,10-11,20,22H,1-3,6-9,19H2,(H,21,24) |
| InChIKey | IAMCWSVWBJVYIO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Didemnum (ncbitaxon:107395) | - | PubMed (21348447) | The freeze dried material was extracted with methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Didemnidine B (CHEBI:67325) has role metabolite (CHEBI:25212) |
| Didemnidine B (CHEBI:67325) is a tryptamines (CHEBI:27162) |
| Synonym | Source |
|---|---|
| N-[3-(4-aminobutylamino)propyl]-2-(6-bromo-1H-indol-3-yl)-2-oxo-acetamide | ChEBI |
| Citations |
|---|