EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N4O2 |
| Net Charge | 0 |
| Average Mass | 316.405 |
| Monoisotopic Mass | 316.18993 |
| SMILES | NCCCCNCCCNC(=O)C(=O)c1cnc2ccccc12 |
| InChI | InChI=1S/C17H24N4O2/c18-8-3-4-9-19-10-5-11-20-17(23)16(22)14-12-21-15-7-2-1-6-13(14)15/h1-2,6-7,12,19,21H,3-5,8-11,18H2,(H,20,23) |
| InChIKey | TUOXXENDICUNMW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Didemnum (ncbitaxon:107395) | - | PubMed (21348447) | The freeze dried material was extracted with methanol |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| didemnidine A (CHEBI:67324) has role metabolite (CHEBI:25212) |
| didemnidine A (CHEBI:67324) is a tryptamines (CHEBI:27162) |
| Synonym | Source |
|---|---|
| N-{3-[(4-Aminobutyl)amino]propyl}-2-(1H-indol-3-yl)-2-oxoacetamide | ChEBI |
| Citations |
|---|