EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H78N6O12 |
| Net Charge | 0 |
| Average Mass | 955.204 |
| Monoisotopic Mass | 954.56777 |
| SMILES | CC[C@H](C)[C@H]1NC(=O)[C@@H](N2CN(C)[C@@H](CC(C)C)C2=O)[C@@H](C)OC(=O)[C@H](Cc2ccc(OC)cc2)N(C)C(=O)[C@@H]2CCCN2C(=O)[C@H](CC(C)C)NC(=O)[C@@H](C)C(=O)[C@H](C(C)C)OC(=O)C[C@@H]1O |
| InChI | InChI=1S/C50H78N6O12/c1-14-30(8)41-39(57)25-40(58)68-44(29(6)7)43(59)31(9)45(60)51-35(22-27(2)3)47(62)55-21-15-16-36(55)48(63)54(12)38(24-33-17-19-34(66-13)20-18-33)50(65)67-32(10)42(46(61)52-41)56-26-53(11)37(49(56)64)23-28(4)5/h17-20,27-32,35-39,41-42,44,57H,14-16,21-26H2,1-13H3,(H,51,60)(H,52,61)/t30-,31-,32+,35-,36-,37-,38-,39-,41+,42-,44-/m0/s1 |
| InChIKey | LSLAZLSLSCFXNW-SOOUQXMNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trididemnum solidum (ncbitaxon:1079459) | - | PubMed (21341712) | MeOH extract of macerated, frozen tunicates |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N'-Methyleno-didemnin A (CHEBI:67323) has role metabolite (CHEBI:25212) |
| N,N'-Methyleno-didemnin A (CHEBI:67323) is a didemnin (CHEBI:90209) |
| Citations |
|---|