EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11ClO5 |
| Net Charge | 0 |
| Average Mass | 222.624 |
| Monoisotopic Mass | 222.02950 |
| SMILES | COC(=O)C1=C[C@@H](O)[C@H](O)[C@H](O)[C@H]1Cl |
| InChI | InChI=1S/C8H11ClO5/c1-14-8(13)3-2-4(10)6(11)7(12)5(3)9/h2,4-7,10-12H,1H3/t4-,5+,6+,7-/m1/s1 |
| InChIKey | AEDMWQPFIPNFCS-JRTVQGFMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Periconia byssoides (fungorum:144538) | - | PubMed (21391658) | Fungus was collected from the sea hare Aplysia kurodai Strain: OUPS N133 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-Pericosine Do (CHEBI:67322) has role metabolite (CHEBI:25212) |
| (-)-Pericosine Do (CHEBI:67322) is a cyclitol (CHEBI:23451) |
| (-)-Pericosine Do (CHEBI:67322) is a methyl ester (CHEBI:25248) |
| Synonym | Source |
|---|---|
| (-)-Methyl (3R,4S,5S,6S)-6-Chloro-3,4,5-trihydroxy-1-cyclohexene-1-carboxylate | ChEBI |
| Citations |
|---|