EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H45N3O5 |
| Net Charge | 0 |
| Average Mass | 503.684 |
| Monoisotopic Mass | 503.33592 |
| SMILES | CCCCCCCC(=O)[C@@H](C)C(=O)N(C)[C@H](Cc1ccc(OC)cc1)C(=O)N(C)[C@H](C(N)=O)C(C)C |
| InChI | InChI=1S/C28H45N3O5/c1-8-9-10-11-12-13-24(32)20(4)27(34)30(5)23(18-21-14-16-22(36-7)17-15-21)28(35)31(6)25(19(2)3)26(29)33/h14-17,19-20,23,25H,8-13,18H2,1-7H3,(H2,29,33)/t20-,23-,25+/m1/s1 |
| InChIKey | KKNYIFDIQAVMQG-XRODADMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | PubMed (21341718) | Lipophilic EtOAc-MeOH(1:1)extract of freeze-dried material,unresolved mixture of majusculamide A&B |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| majusculamide A (CHEBI:67320) has role metabolite (CHEBI:25212) |
| majusculamide A (CHEBI:67320) is a amino acid amide (CHEBI:22475) |
| Synonym | Source |
|---|---|
| N,O-Dimethyl-N-[(2R)-2-methyl-3-oxodecanoyl]-D-tyrosyl-N2-methyl-L-valinamide | ChEBI |
| Citations |
|---|