EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H45ClN2O6 |
| Net Charge | 0 |
| Average Mass | 541.129 |
| Monoisotopic Mass | 540.29661 |
| SMILES | CCCCCCC[C@@H](C/C=C/CCC(=O)N(C)C/C(=C/Cl)C/C(=C\C(=O)N1CC(O)CC1=O)OC)OC |
| InChI | InChI=1S/C28H45ClN2O6/c1-5-6-7-8-10-13-24(36-3)14-11-9-12-15-26(33)30(2)20-22(19-29)16-25(37-4)18-28(35)31-21-23(32)17-27(31)34/h9,11,18-19,23-24,32H,5-8,10,12-17,20-21H2,1-4H3/b11-9+,22-19+,25-18+/t23?,24-/m0/s1 |
| InChIKey | LCTQNEJUQPJWPJ-LQFFYNKWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | PubMed (21341718) | Lipophilic extract afforded by extraction of freeze-dried material with EtOAc-MeOH (1:1) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malyngamide B (CHEBI:67319) has role metabolite (CHEBI:25212) |
| malyngamide B (CHEBI:67319) is a N-acylpyrrolidine (CHEBI:46766) |
| Citations |
|---|