EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H47ClN2O7 |
| Net Charge | 0 |
| Average Mass | 559.144 |
| Monoisotopic Mass | 558.30718 |
| SMILES | CCCCCCC[C@@H](C/C=C/CCC(=O)N(C)C/C(=C\Cl)CC(=O)CC(=O)NC[C@H](O)CC(=O)OC)OC |
| InChI | InChI=1S/C28H47ClN2O7/c1-5-6-7-8-10-13-25(37-3)14-11-9-12-15-27(35)31(2)21-22(19-29)16-23(32)17-26(34)30-20-24(33)18-28(36)38-4/h9,11,19,24-25,33H,5-8,10,12-18,20-21H2,1-4H3,(H,30,34)/b11-9+,22-19-/t24-,25+/m1/s1 |
| InChIKey | FGRVZQUFZGRBFK-RBZBVOEWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | PubMed (21341718) | Lipophilic extract afforded by extraction of freeze-dried material with EtOAc-MeOH (1:1) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Malyngamide 3 (CHEBI:67315) has functional parent γ-amino acid (CHEBI:33707) |
| Malyngamide 3 (CHEBI:67315) has role metabolite (CHEBI:25212) |
| Malyngamide 3 (CHEBI:67315) is a organonitrogen compound (CHEBI:35352) |
| Malyngamide 3 (CHEBI:67315) is a organooxygen compound (CHEBI:36963) |
| Synonym | Source |
|---|---|
| Methyl (3R)-4-{[(5Z)-6-chloro-5-({[(4E,7S)-7-methoxy-4-tetradecenoyl](methyl)amino}methyl)-3-oxo-5-hexenoyl]amino}-3-hydroxybutanoate | ChEBI |
| Citations |
|---|