EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30O5 |
| Net Charge | 0 |
| Average Mass | 386.488 |
| Monoisotopic Mass | 386.20932 |
| SMILES | [H][C@]12CC[C@]3(C)OC(=O)C=C3[C@]1(C)[C@H](OC(C)=O)C[C@@]1([H])C(C)(C)C(=O)C=C[C@]21C |
| InChI | InChI=1S/C23H30O5/c1-13(24)27-18-11-15-20(2,3)17(25)8-9-21(15,4)14-7-10-22(5)16(23(14,18)6)12-19(26)28-22/h8-9,12,14-15,18H,7,10-11H2,1-6H3/t14-,15+,18-,21-,22+,23-/m1/s1 |
| InChIKey | AJBUFFHLKFFHRG-RPHKCIOSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | Defatted MeOH extract of seeds |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-nimolactone (CHEBI:67314) has role plant metabolite (CHEBI:76924) |
| β-nimolactone (CHEBI:67314) is a acetate ester (CHEBI:47622) |
| β-nimolactone (CHEBI:67314) is a cyclic terpene ketone (CHEBI:36130) |
| β-nimolactone (CHEBI:67314) is a enone (CHEBI:51689) |
| β-nimolactone (CHEBI:67314) is a limonoid (CHEBI:39434) |
| β-nimolactone (CHEBI:67314) is a organic heterotetracyclic compound (CHEBI:38163) |
| β-nimolactone (CHEBI:67314) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3bR,4R,5aR,9aR,9bR,11aS)-3b,6,6,9a,11a-pentamethyl-2,7-dioxo-2,3b,4,5,5a,6,7,9a,9b,10,11,11a-dodecahydrophenanthro[2,1-b]furan-4-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5857534 | Reaxys |
| Citations |
|---|