EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H44O9 |
| Net Charge | 0 |
| Average Mass | 644.761 |
| Monoisotopic Mass | 644.29853 |
| SMILES | [H][C@]12OC[C@]3(C)[C@H](OC(C)=O)C[C@H](OC(=O)/C=C/c4ccccc4)[C@](C)([C@@H](CC(=O)OC)[C@]4(C)C5=C(C)[C@H](c6ccoc6)C[C@@]5([H])O[C@]14[H])[C@@]23[H] |
| InChI | InChI=1S/C38H44O9/c1-21-25(24-14-15-43-19-24)16-26-32(21)38(5)27(17-31(41)42-6)37(4)29(47-30(40)13-12-23-10-8-7-9-11-23)18-28(45-22(2)39)36(3)20-44-33(34(36)37)35(38)46-26/h7-15,19,25-29,33-35H,16-18,20H2,1-6H3/b13-12+/t25-,26-,27-,28-,29+,33-,34+,35-,36-,37+,38-/m1/s1 |
| InChIKey | JYFHWXOCTSBEPC-CUNMOGCISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | n-Hexane extract of seeds |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ohchinin acetate (CHEBI:67308) has role metabolite (CHEBI:25212) |
| ohchinin acetate (CHEBI:67308) has role plant metabolite (CHEBI:76924) |
| ohchinin acetate (CHEBI:67308) is a acetate ester (CHEBI:47622) |
| ohchinin acetate (CHEBI:67308) is a cinnamate ester (CHEBI:36087) |
| ohchinin acetate (CHEBI:67308) is a furans (CHEBI:24129) |
| ohchinin acetate (CHEBI:67308) is a limonoid (CHEBI:39434) |
| ohchinin acetate (CHEBI:67308) is a methyl ester (CHEBI:25248) |
| ohchinin acetate (CHEBI:67308) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (2aR,3R,5S,5aR,6R,6aR,8R,9aR,10aS,10bR,10cR)-3-(acetyloxy)-8-(furan-3-yl)-6-(2-methoxy-2-oxoethyl)-2a,5a,6a,7-tetramethyl-2a,4,5,5a,6,6a,8,9,9a,10a,10b,10c-dodecahydro-2H,3H-cyclopenta[d]naphtho[2,3-b:1,8-b'c']difuran-5-yl (2E)-3-phenylprop-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6464645 | Reaxys |
| Citations |
|---|