EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H44O9 |
| Net Charge | 0 |
| Average Mass | 644.761 |
| Monoisotopic Mass | 644.29853 |
| SMILES | [H][C@]12OC[C@]3(C)[C@H](OC(C)=O)C[C@H](OC(=O)/C=C/c4ccccc4)[C@](C)([C@@H](CC(=O)OC)[C@]4(C)C5=C(C)[C@H](c6ccoc6)C[C@@]5([H])O[C@]14[H])[C@@]23[H] |
| InChI | InChI=1S/C38H44O9/c1-21-25(24-14-15-43-19-24)16-26-32(21)38(5)27(17-31(41)42-6)37(4)29(47-30(40)13-12-23-10-8-7-9-11-23)18-28(45-22(2)39)36(3)20-44-33(34(36)37)35(38)46-26/h7-15,19,25-29,33-35H,16-18,20H2,1-6H3/b13-12+/t25-,26-,27-,28-,29+,33-,34+,35-,36-,37+,38-/m1/s1 |
| InChIKey | JYFHWXOCTSBEPC-CUNMOGCISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | n-Hexane extract of seeds |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ohchinin acetate (CHEBI:67308) has role metabolite (CHEBI:25212) |
| ohchinin acetate (CHEBI:67308) has role plant metabolite (CHEBI:76924) |
| ohchinin acetate (CHEBI:67308) is a acetate ester (CHEBI:47622) |
| ohchinin acetate (CHEBI:67308) is a cinnamate ester (CHEBI:36087) |
| ohchinin acetate (CHEBI:67308) is a furans (CHEBI:24129) |
| ohchinin acetate (CHEBI:67308) is a limonoid (CHEBI:39434) |
| ohchinin acetate (CHEBI:67308) is a methyl ester (CHEBI:25248) |
| ohchinin acetate (CHEBI:67308) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (2aR,3R,5S,5aR,6R,6aR,8R,9aR,10aS,10bR,10cR)-3-(acetyloxy)-8-(furan-3-yl)-6-(2-methoxy-2-oxoethyl)-2a,5a,6a,7-tetramethyl-2a,4,5,5a,6,6a,8,9,9a,10a,10b,10c-dodecahydro-2H,3H-cyclopenta[d]naphtho[2,3-b:1,8-b'c']difuran-5-yl (2E)-3-phenylprop-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6464645 | Reaxys |
| Citations |
|---|