EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O8 |
| Net Charge | 0 |
| Average Mass | 498.572 |
| Monoisotopic Mass | 498.22537 |
| SMILES | [H][C@@]12[C@@H](O)[C@@]3([H])O[C@]4([H])C[C@@H](c5ccoc5)C(C)=C4[C@@]3(C)[C@H](CC(=O)OC)[C@@]1(C)C(=O)C=C[C@@]2(C)C(=O)OC |
| InChI | InChI=1S/C28H34O8/c1-14-16(15-8-10-35-13-15)11-17-21(14)28(4)18(12-20(30)33-5)27(3)19(29)7-9-26(2,25(32)34-6)23(27)22(31)24(28)36-17/h7-10,13,16-18,22-24,31H,11-12H2,1-6H3/t16-,17-,18-,22-,23+,24-,26-,27+,28-/m1/s1 |
| InChIKey | CTBHKOAPXBDFPX-PQYHCQQJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | Defatted MeOH extract of seeds |
| Roles Classification |
|---|
| Biological Roles: | insect growth regulator A growth regulator that inhibits the life cycle of an insect. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antifeedant A substance that prevents pests from feeding. insect growth regulator A growth regulator that inhibits the life cycle of an insect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-deacetylnimbin (CHEBI:67305) has functional parent nimbin (CHEBI:67304) |
| 6-deacetylnimbin (CHEBI:67305) has role antifeedant (CHEBI:22583) |
| 6-deacetylnimbin (CHEBI:67305) has role insect growth regulator (CHEBI:24851) |
| 6-deacetylnimbin (CHEBI:67305) has role plant metabolite (CHEBI:76924) |
| 6-deacetylnimbin (CHEBI:67305) is a cyclic terpene ketone (CHEBI:36130) |
| 6-deacetylnimbin (CHEBI:67305) is a diester (CHEBI:51307) |
| 6-deacetylnimbin (CHEBI:67305) is a enone (CHEBI:51689) |
| 6-deacetylnimbin (CHEBI:67305) is a furans (CHEBI:24129) |
| 6-deacetylnimbin (CHEBI:67305) is a limonoid (CHEBI:39434) |
| 6-deacetylnimbin (CHEBI:67305) is a methyl ester (CHEBI:25248) |
| 6-deacetylnimbin (CHEBI:67305) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| methyl (2R,3aR,4aS,5R,5aR,6R,9aR,10S,10aR)-2-(furan-3-yl)-5-hydroxy-10-(2-methoxy-2-oxoethyl)-1,6,9a,10a-tetramethyl-9-oxo-3,3a,4a,5,5a,6,9,9a,10,10a-decahydro-2H-cyclopenta[b]naphtho[2,3-d]furan-6-carboxylate |
| Synonym | Source |
|---|---|
| nimbic acid dimethyl ester | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:70922 | Reaxys |
| CAS:18609-16-0 | ChemIDplus |
| Citations |
|---|