EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H48O17 |
| Net Charge | 0 |
| Average Mass | 752.763 |
| Monoisotopic Mass | 752.28915 |
| SMILES | [H][C@@]12O[C@@H](OC)C[C@]1(O)[C@]1([H])C[C@]([H])(O2)[C@@]2([C@]3(C)[C@H](O)[C@]4([H])OC[C@]5(C(=O)OC)[C@H](OC(C)=O)C[C@H](OC(=O)/C(C)=C/C)[C@@]6(CO[C@](O)(C(=O)OC)[C@@]36[H])[C@@]45[H])O[C@@]12C |
| InChI | InChI=1S/C36H48O17/c1-9-15(2)25(39)50-18-11-19(49-16(3)37)33(27(40)45-7)13-47-22-23(33)32(18)14-48-35(43,28(41)46-8)26(32)30(4,24(22)38)36-20-10-17(31(36,5)53-36)34(42)12-21(44-6)52-29(34)51-20/h9,17-24,26,29,38,42-43H,10-14H2,1-8H3/b15-9+/t17-,18+,19-,20+,21-,22-,23-,24-,26+,29-,30-,31+,32+,33+,34+,35+,36+/m1/s1 |
| InChIKey | HAIAPLNAMFKNPR-QYMXIDFGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | Defatted MeOH extract of seeds |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 23-epivepaol (CHEBI:67302) has functional parent tiglic acid (CHEBI:9592) |
| 23-epivepaol (CHEBI:67302) has role metabolite (CHEBI:25212) |
| 23-epivepaol (CHEBI:67302) has role plant metabolite (CHEBI:76924) |
| 23-epivepaol (CHEBI:67302) is a acetate ester (CHEBI:47622) |
| 23-epivepaol (CHEBI:67302) is a epoxide (CHEBI:32955) |
| 23-epivepaol (CHEBI:67302) is a limonoid (CHEBI:39434) |
| 23-epivepaol (CHEBI:67302) is a methyl ester (CHEBI:25248) |
| 23-epivepaol (CHEBI:67302) is a secondary alcohol (CHEBI:35681) |
| 23-epivepaol (CHEBI:67302) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| dimethyl (2aR,3S,4S,4aR,5S,7aS,8S,10R,10aS,10bR)-10-(acetyloxy)-3,5-dihydroxy-4-[(1aR,2S,3aR,5R,6aS,7S,7aS)-6a-hydroxy-5-methoxy-7a-methylhexahydro-2,7-methanofuro[2,3-b]oxireno[e]oxepin-1a(2H)-yl]-4-methyl-8-{[(2E)-2-methylbut-2-enoyl]oxy}octahydro-1H-naphtho[1,8a-c:4,5-b'c']difuran-5,10a(8H)-dicarboxylate |
| Synonym | Source |
|---|---|
| Isovepaol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11303121 | Reaxys |
| Citations |
|---|