EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O7 |
| Net Charge | 0 |
| Average Mass | 482.573 |
| Monoisotopic Mass | 482.23045 |
| SMILES | [H][C@]12CC[C@]3(C)C(=CC(=O)O[C@]3(O)c3ccoc3)[C@]1(C)[C@H](OC(C)=O)C[C@@]1([H])C(C)(C)C(=O)C=C[C@]21C |
| InChI | InChI=1S/C28H34O7/c1-16(29)34-22-13-19-24(2,3)21(30)8-10-25(19,4)18-7-11-26(5)20(27(18,22)6)14-23(31)35-28(26,32)17-9-12-33-15-17/h8-10,12,14-15,18-19,22,32H,7,11,13H2,1-6H3/t18-,19+,22-,25-,26-,27-,28-/m1/s1 |
| InChIKey | VXKRRVRNHBWLTO-VBPYNQNZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | Defatted MeOH extract of seeds |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nimolicinol (CHEBI:67298) has role plant metabolite (CHEBI:76924) |
| nimolicinol (CHEBI:67298) is a acetate ester (CHEBI:47622) |
| nimolicinol (CHEBI:67298) is a cyclic terpene ketone (CHEBI:36130) |
| nimolicinol (CHEBI:67298) is a enone (CHEBI:51689) |
| nimolicinol (CHEBI:67298) is a furans (CHEBI:24129) |
| nimolicinol (CHEBI:67298) is a limonoid (CHEBI:39434) |
| nimolicinol (CHEBI:67298) is a tertiary alcohol (CHEBI:26878) |
| nimolicinol (CHEBI:67298) is a tetracyclic triterpenoid (CHEBI:26893) |
| nimolicinol (CHEBI:67298) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1S,4bR,5R,6aR,10aR,10bR,12aR)-1-(furan-3-yl)-1-hydroxy-4b,7,7,10a,12a-pentamethyl-3,8-dioxo-3,4b,5,6,6a,7,8,10a,10b,11,12,12a-dodecahydro-1H-naphtho[2,1-f]isochromen-5-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9235734 | Reaxys |
| Citations |
|---|