EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40O7 |
| Net Charge | 0 |
| Average Mass | 512.643 |
| Monoisotopic Mass | 512.27740 |
| SMILES | [H][C@]12CC[C@]3(C)C(=CC[C@H]3c3ccoc3)[C@]1(C)[C@H](O)[C@]1([H])OC[C@]3(C)[C@H](OC(C)=O)C[C@H](OC(C)=O)[C@@]2(C)[C@@]13[H] |
| InChI | InChI=1S/C30H40O7/c1-16(31)36-22-13-23(37-17(2)32)30(6)21-9-11-27(3)19(18-10-12-34-14-18)7-8-20(27)29(21,5)26(33)24-25(30)28(22,4)15-35-24/h8,10,12,14,19,21-26,33H,7,9,11,13,15H2,1-6H3/t19-,21-,22+,23-,24+,25-,26+,27-,28+,29-,30-/m0/s1 |
| InChIKey | WGBLBVXSYGYVPN-VQDQNZKNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | n-Hexane extract of seeds |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-diacetylvilasinin (CHEBI:67293) has role metabolite (CHEBI:25212) |
| 1,3-diacetylvilasinin (CHEBI:67293) has role plant metabolite (CHEBI:76924) |
| 1,3-diacetylvilasinin (CHEBI:67293) is a acetate ester (CHEBI:47622) |
| 1,3-diacetylvilasinin (CHEBI:67293) is a furans (CHEBI:24129) |
| 1,3-diacetylvilasinin (CHEBI:67293) is a limonoid (CHEBI:39434) |
| 1,3-diacetylvilasinin (CHEBI:67293) is a pentacyclic triterpenoid (CHEBI:25872) |
| 1,3-diacetylvilasinin (CHEBI:67293) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1S,3R,3aR,5aR,6S,6aR,9R,9aS,11aR,11bR,11cR)-9-(furan-3-yl)-6-hydroxy-3a,6a,9a,11b-tetramethyl-1,2,3,3a,4,5a,6,6a,8,9,9a,10,11,11a,11b,11c-hexadecahydrocyclopenta[7,8]phenanthro[10,1-bc]furan-1,3-diyl diacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8023231 | Reaxys |
| Citations |
|---|