EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15AsN6OS2 |
| Net Charge | 0 |
| Average Mass | 398.349 |
| Monoisotopic Mass | 397.99647 |
| SMILES | Nc1nc(N)nc(Nc2ccc([As]3SCC(CO)S3)cc2)n1 |
| InChI | InChI=1S/C12H15AsN6OS2/c14-10-17-11(15)19-12(18-10)16-8-3-1-7(2-4-8)13-21-6-9(5-20)22-13/h1-4,9,20H,5-6H2,(H5,14,15,16,17,18,19) |
| InChIKey | JCYZMTMYPZHVBF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Melarsoprol (CHEBI:6729) has role antileishmanial agent (CHEBI:70868) |
| Melarsoprol (CHEBI:6729) is a triazines (CHEBI:38102) |
| Synonyms | Source |
|---|---|
| arsobal | DrugCentral |
| melarsaprol | DrugCentral |
| melarsen B | DrugCentral |
| Melarsoprol | KEGG COMPOUND |
| RP 3854 | ChEMBL |
| RP-3854 | ChEMBL |
| Brand Name | Source |
|---|---|
| Mel b | ChEMBL |
| Citations |
|---|