EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O6 |
| Net Charge | 0 |
| Average Mass | 466.574 |
| Monoisotopic Mass | 466.23554 |
| SMILES | [H][C@]12CC[C@]3(C)C(=CC(=O)[C@]3(O)c3ccoc3)[C@]1(C)[C@H](OC(C)=O)C[C@@]1([H])C(C)(C)C(=O)C=C[C@]21C |
| InChI | InChI=1S/C28H34O6/c1-16(29)34-23-14-19-24(2,3)21(30)8-10-25(19,4)18-7-11-26(5)20(27(18,23)6)13-22(31)28(26,32)17-9-12-33-15-17/h8-10,12-13,15,18-19,23,32H,7,11,14H2,1-6H3/t18-,19+,23-,25-,26-,27-,28-/m1/s1 |
| InChIKey | QXKHBVSTPRHRQV-CMBOGFGBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | Defatted MeOH extract of seeds |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-epi-17-hydroxyazadiradione (CHEBI:67288) has functional parent 17-epiazadiradione (CHEBI:67287) |
| 17-epi-17-hydroxyazadiradione (CHEBI:67288) has role antineoplastic agent (CHEBI:35610) |
| 17-epi-17-hydroxyazadiradione (CHEBI:67288) has role metabolite (CHEBI:25212) |
| 17-epi-17-hydroxyazadiradione (CHEBI:67288) has role plant metabolite (CHEBI:76924) |
| 17-epi-17-hydroxyazadiradione (CHEBI:67288) is a acetate ester (CHEBI:47622) |
| 17-epi-17-hydroxyazadiradione (CHEBI:67288) is a cyclic terpene ketone (CHEBI:36130) |
| 17-epi-17-hydroxyazadiradione (CHEBI:67288) is a furans (CHEBI:24129) |
| 17-epi-17-hydroxyazadiradione (CHEBI:67288) is a limonoid (CHEBI:39434) |
| 17-epi-17-hydroxyazadiradione (CHEBI:67288) is a tertiary alcohol (CHEBI:26878) |
| 17-epi-17-hydroxyazadiradione (CHEBI:67288) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| 17-epi-17-hydroxyazadiradione (CHEBI:67288) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (5α,7α,13α,17α)-17-(furan-3-yl)-17-hydroxy-4,4,8-trimethyl-3,16-dioxoandrosta-1,14-dien-7-yl acetate |
| Manual Xrefs | Databases |
|---|---|
| WO2008026300 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21448576 | Reaxys |
| Citations |
|---|