EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O5 |
| Net Charge | 0 |
| Average Mass | 354.402 |
| Monoisotopic Mass | 354.14672 |
| SMILES | CC[C@H](C)CCc1c(O)c(C)c(O)c2c1C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C21H22O5/c1-4-10(2)8-9-13-16-17(19(24)11(3)18(13)23)20(25)12-6-5-7-14(22)15(12)21(16)26/h5-7,10,22-24H,4,8-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | AEKIVMGNSYCSFZ-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Micromonospora lupini (ncbitaxon:1150864) | - | PubMed (21226490) | Endophytic actinomycete isolated from the root nodule of Lupinus angustifolius Strain: Lupac 08 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lupinacidin C (CHEBI:67279) has role metabolite (CHEBI:25212) |
| lupinacidin C (CHEBI:67279) is a trihydroxyanthraquinone (CHEBI:37488) |
| Synonym | Source |
|---|---|
| 1,3,5-Trihydroxy-2-methyl-4-[(3S)-3-methylpentyl]-9,10-anthraquinone | ChEBI |
| Citations |
|---|