EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O11 |
| Net Charge | 0 |
| Average Mass | 578.655 |
| Monoisotopic Mass | 578.27271 |
| SMILES | [H][C@@]12[C@H](OC(C)=O)[C@]34O[C@@]3(C)C(=O)O[C@@]4([H])/C=C(/C)[C@H](OC(=O)CCCCC)C[C@H](O)[C@@]1(C)C=C[C@@H](OC(C)=O)[C@@]2(C)O |
| InChI | InChI=1S/C30H42O11/c1-8-9-10-11-23(34)39-19-15-20(33)27(5)13-12-21(37-17(3)31)28(6,36)24(27)25(38-18(4)32)30-22(14-16(19)2)40-26(35)29(30,7)41-30/h12-14,19-22,24-25,33,36H,8-11,15H2,1-7H3/b16-14-/t19-,20+,21-,22+,24-,25+,27-,28-,29+,30+/m1/s1 |
| InChIKey | FRHNNILIALBLSU-XIVSLCBISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Briareum (ncbitaxon:86542) | - | PubMed (21438584) | The CH2Cl2:MeOH (1:1) extract of Briareum sp |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Brialalepolide B (CHEBI:67277) has role metabolite (CHEBI:25212) |
| Brialalepolide B (CHEBI:67277) is a hexanoate ester (CHEBI:87656) |
| Citations |
|---|