EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H21N5O |
| Net Charge | 0 |
| Average Mass | 407.477 |
| Monoisotopic Mass | 407.17461 |
| SMILES | NC1(c2ccc(-c3nc4ccn5c(=O)nnc5c4cc3-c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C25H21N5O/c26-25(12-4-13-25)18-9-7-17(8-10-18)22-19(16-5-2-1-3-6-16)15-20-21(27-22)11-14-30-23(20)28-29-24(30)31/h1-3,5-11,14-15H,4,12-13,26H2,(H,29,31) |
| InChIKey | ULDXWLCXEDXJGE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MK-2206 (CHEBI:67271) has role antineoplastic agent (CHEBI:35610) |
| MK-2206 (CHEBI:67271) has role apoptosis inducer (CHEBI:68495) |
| MK-2206 (CHEBI:67271) has role autophagy inducer (CHEBI:138880) |
| MK-2206 (CHEBI:67271) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| MK-2206 (CHEBI:67271) is a benzenes (CHEBI:22712) |
| MK-2206 (CHEBI:67271) is a cyclobutanes (CHEBI:156473) |
| MK-2206 (CHEBI:67271) is a organic heterotricyclic compound (CHEBI:26979) |
| MK-2206 (CHEBI:67271) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl[1,2,4]triazolo[3,4-f][1,6]naphthyridin-3(2H)-one |
| Synonyms | Source |
|---|---|
| 8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-1,2,4-triazolo[3,4-f][1,6]naphthyridin-3(2H)-one | ChEBI |
| MK 2206 | ChEBI |
| MK2206 | ChEBI |
| MK-2206 free base | DrugBank |
| Citations |
|---|