EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O8 |
| Net Charge | 0 |
| Average Mass | 226.181 |
| Monoisotopic Mass | 226.06887 |
| SMILES | O=C(O)[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A22122h]/1/ |
| InChI | InChI=1S/C7H14O8/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15/h2-6,8-13H,1H2,(H,14,15)/t2-,3-,4+,5-,6-/m1/s1 |
| InChIKey | KWMLJOLKUYYJFJ-VFUOTHLCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucoheptonic acid (CHEBI:67270) has functional parent heptanoic acid (CHEBI:45571) |
| glucoheptonic acid (CHEBI:67270) has role metabolite (CHEBI:25212) |
| glucoheptonic acid (CHEBI:67270) is a carbohydrate acid (CHEBI:33720) |
| glucoheptonic acid (CHEBI:67270) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| D-glycero-D-gulo-heptonic acid |
| Synonyms | Source |
|---|---|
| (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoic acid | IUPAC |
| α-glucoheptonic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1372992 | Reaxys |
| CAS:87-74-1 | ChemIDplus |
| Citations |
|---|