EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O |
| Net Charge | 0 |
| Average Mass | 262.437 |
| Monoisotopic Mass | 262.22967 |
| SMILES | CC(=O)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H30O/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19/h9,11,13H,6-8,10,12,14H2,1-5H3/b16-11+,17-13+ |
| InChIKey | LTUMRKDLVGQMJU-IUBLYSDUSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| farnesyl acetone (CHEBI:67252) has part 2-trans,6-trans-farnesyl group (CHEBI:36535) |
| farnesyl acetone (CHEBI:67252) has role hormone (CHEBI:24621) |
| farnesyl acetone (CHEBI:67252) has role metabolite (CHEBI:25212) |
| farnesyl acetone (CHEBI:67252) is a terpene ketone (CHEBI:26872) |
| IUPAC Name |
|---|
| (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-one |
| Synonyms | Source |
|---|---|
| (E,E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-one | ChemIDplus |
| (E,E)-farnesylacetone | MetaCyc |
| trans,trans-farnesylacetone | MetaCyc |
| farnesylacetone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-12898 | MetaCyc |
| US2010204520 | Patent |
| WO2009019132 | Patent |
| EP2188240 | Patent |
| Citations |
|---|