EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O4 |
| Net Charge | 0 |
| Average Mass | 146.142 |
| Monoisotopic Mass | 146.05791 |
| SMILES | O[C@@H]1[C@H](O)[C@@H](O)C=C[C@H]1O |
| InChI | InChI=1S/C6H10O4/c7-3-1-2-4(8)6(10)5(3)9/h1-10H/t3-,4+,5+,6- |
| InChIKey | LRUBQXAKGXQBHA-GUCUJZIJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| conduritol A (CHEBI:67221) has role metabolite (CHEBI:25212) |
| conduritol A (CHEBI:67221) is a conduritol (CHEBI:67218) |
| IUPAC Name |
|---|
| (1R,2S,3R,4S)-cyclohex-5-ene-1,2,3,4-tetrol |
| Synonyms | Source |
|---|---|
| (1S,2R,3S,4R)-cyclohex-5-ene-1,2,3,4-tetrol | IUPAC |
| (1RS,2SR,3RS,4SR)-5-cyclohexene-1,2,3,4-tetrol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2044131 | Reaxys |
| Citations |
|---|