EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:67206 - geranyl acetone
| Formula | C13H22O |
| Net Charge | 0 |
| Average Mass | 194.318 |
| Monoisotopic Mass | 194.16707 |
| SMILES | CC(=O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C13H22O/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h7,9H,5-6,8,10H2,1-4H3/b12-9+ |
| InChIKey | HNZUNIKWNYHEJJ-FMIVXFBMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nelumbo nucifera (ncbitaxon:4432) | - | PubMed (19919095) |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geranyl acetone (CHEBI:67206) has part geranyl group (CHEBI:24224) |
| geranyl acetone (CHEBI:67206) has role flavouring agent (CHEBI:35617) |
| geranyl acetone (CHEBI:67206) has role fragrance (CHEBI:48318) |
| geranyl acetone (CHEBI:67206) has role plant metabolite (CHEBI:76924) |
| geranyl acetone (CHEBI:67206) has role volatile oil component (CHEBI:27311) |
| geranyl acetone (CHEBI:67206) is a monoterpene ketone (CHEBI:25408) |
| IUPAC Name |
|---|
| (5E)-6,10-dimethylundeca-5,9-dien-2-one |
| Synonyms | Source |
|---|---|
| trans-Geranylacetone | NIST Chemistry WebBook |
| (E)-6,10-Dimethylundeca-5,9-dien-2-one | NIST Chemistry WebBook |
| (E)-6,10-dimethyl-5,9-undecadien-2-one | NIST Chemistry WebBook |
| geranylacetone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031846 | HMDB |
| Citations |
|---|