EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17N3O2 |
| Net Charge | 0 |
| Average Mass | 175.232 |
| Monoisotopic Mass | 175.13208 |
| SMILES | NCCCNCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H17N3O2/c8-3-1-4-10-5-2-6(9)7(11)12/h6,10H,1-5,8-9H2,(H,11,12)/t6-/m0/s1 |
| InChIKey | KFJYMJZJSUORBX-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carboxynorspermidine (CHEBI:67204) has parent hydride bis(3-aminopropyl)amine (CHEBI:16841) |
| carboxynorspermidine (CHEBI:67204) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| carboxynorspermidine (CHEBI:67204) is conjugate base of carboxynorspermidine(2+) (CHEBI:65070) |
| Incoming Relation(s) |
| carboxynorspermidine(2+) (CHEBI:65070) is conjugate acid of carboxynorspermidine (CHEBI:67204) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-[(3-aminopropyl)amino]butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C18174 | KEGG COMPOUND |
| Citations |
|---|