EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18 |
| Net Charge | 0 |
| Average Mass | 114.232 |
| Monoisotopic Mass | 114.14085 |
| SMILES | CCCC(C)CCC |
| InChI | InChI=1S/C8H18/c1-4-6-8(3)7-5-2/h8H,4-7H2,1-3H3 |
| InChIKey | CHBAWFGIXDBEBT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylheptane (CHEBI:67193) has role plant metabolite (CHEBI:76924) |
| 4-methylheptane (CHEBI:67193) is a alkane (CHEBI:18310) |
| Incoming Relation(s) |
| (2E,4E,6E)-7-hydroxy-4-methylhepta-2,4,6-trienal (CHEBI:67191) has parent hydride 4-methylheptane (CHEBI:67193) |
| IUPAC Name |
|---|
| 4-methylheptane |
| Manual Xrefs | Databases |
|---|---|
| LMFA11000608 | LIPID MAPS |
| Citations |
|---|