EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16F6N2O.HCl |
| Net Charge | 0 |
| Average Mass | 414.777 |
| Monoisotopic Mass | 414.09336 |
| SMILES | Cl.[H][C@]1([C@@H](O)c2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)CCCCN1 |
| InChI | InChI=1S/C17H16F6N2O.ClH/c18-16(19,20)11-5-3-4-9-10(15(26)12-6-1-2-7-24-12)8-13(17(21,22)23)25-14(9)11;/h3-5,8,12,15,24,26H,1-2,6-7H2;1H/t12-,15+;/m1./s1 |
| InChIKey | WESWYMRNZNDGBX-YLCXCWDSSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mefloquine hydrochloride (CHEBI:6719) has role antimalarial (CHEBI:38068) |
| Mefloquine hydrochloride (CHEBI:6719) is a hydrochloride (CHEBI:36807) |
| Synonyms | Source |
|---|---|
| Lariam | KEGG COMPOUND |
| Loriam | ChEMBL |
| Mefloquine hydrochloride | KEGG COMPOUND |
| Mefloquini hydrochloridum | ChEMBL |
| NSC-157387 | ChEMBL |
| RO-21-5998 | ChEMBL |
| Brand Name | Source |
|---|---|
| Fansimef | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00831 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:51773-92-3 | KEGG COMPOUND |
| Citations |
|---|