EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56 |
| Net Charge | 0 |
| Average Mass | 536.888 |
| Monoisotopic Mass | 536.43820 |
| SMILES | CC1=C(/C=C/C(C)=C\C=C\C(C)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\C2=C(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-22,25-28H,15-16,23-24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21-,34-22+ |
| InChIKey | OENHQHLEOONYIE-BVZAMQQESA-N |
| Roles Classification |
|---|
| Biological Role: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-cis-β-carotene (CHEBI:67188) has role biological pigment (CHEBI:26130) |
| 9-cis-β-carotene (CHEBI:67188) is a carotenoid (CHEBI:23044) |
| IUPAC Name |
|---|
| 9-cis-β,β-carotene |
| Synonyms | Source |
|---|---|
| (9Z)-β-carotene | ChEBI |
| neo-β-carotene U | ChEBI |
| UniProt Name | Source |
|---|---|
| 9-cis-β-carotene | UniProt |
| Citations |
|---|