EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H37NO |
| Net Charge | 0 |
| Average Mass | 271.489 |
| Monoisotopic Mass | 271.28751 |
| SMILES | CCCCCCCCCCCCCCC[C@@H](O)CN |
| InChI | InChI=1S/C17H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(19)16-18/h17,19H,2-16,18H2,1H3/t17-/m1/s1 |
| InChIKey | UGVBFHUWZNNKIK-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-deoxymethylsphinganine (CHEBI:67187) has functional parent sphinganine (CHEBI:16566) |
| 1-deoxymethylsphinganine (CHEBI:67187) is a amino alcohol (CHEBI:22478) |
| 1-deoxymethylsphinganine (CHEBI:67187) is a sphingoid (CHEBI:35785) |
| 1-deoxymethylsphinganine (CHEBI:67187) is conjugate base of 1-deoxymethylsphinganine(1+) (CHEBI:67108) |
| Incoming Relation(s) |
| 1-deoxymethylsphinganine(1+) (CHEBI:67108) is conjugate acid of 1-deoxymethylsphinganine (CHEBI:67187) |
| IUPAC Name |
|---|
| (2R)-1-aminoheptadecan-2-ol |
| Synonyms | Source |
|---|---|
| m17:0 | ChEBI |
| deoxymethyl-SA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21308751 | Reaxys |
| Citations |
|---|