EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30N4O16P2 |
| Net Charge | 0 |
| Average Mass | 632.409 |
| Monoisotopic Mass | 632.11320 |
| SMILES | CC(=O)N[C@H]1[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3ccc(=O)nc3=O)[C@H](O)[C@@H]2O)O[C@H](C)[C@@H](NC(C)=O)[C@@H]1O |
| InChI | InChI=1S/C19H30N4O16P2/c1-7-12(20-8(2)24)15(28)13(21-9(3)25)18(36-7)38-41(33,34)39-40(31,32)35-6-10-14(27)16(29)17(37-10)23-5-4-11(26)22-19(23)30/h4-5,7,10,12-18,27-29H,6H2,1-3H3,(H,20,24)(H,21,25)(H,31,32)(H,33,34)(H,22,26,30)/t7-,10-,12-,13-,14-,15+,16-,17-,18-/m1/s1 |
| InChIKey | KCAODEOZHCZEBC-TUHJILAWSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-N,N'-diacetylbacillosamine (CHEBI:67178) has functional parent bacillosamine (CHEBI:32538) |
| UDP-N,N'-diacetylbacillosamine (CHEBI:67178) is a UDP-amino sugar (CHEBI:35262) |
| UDP-N,N'-diacetylbacillosamine (CHEBI:67178) is conjugate acid of UDP-N,N'-diacetylbacillosamine(2−) (CHEBI:67134) |
| Incoming Relation(s) |
| UDP-N,N'-diacetylbacillosamine(2−) (CHEBI:67134) is conjugate base of UDP-N,N'-diacetylbacillosamine (CHEBI:67178) |
| IUPAC Name |
|---|
| uridine 5'-{3-[2,4-diacetamido-2,4,6-trideoxy-α-D-glucopyranosyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| UDP-diNAcBac | ChEBI |
| UDP-2,4-Diacetamido-2,4,6-trideoxy-alpha-D-glucopyranose | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C20357 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18560559 | Reaxys |
| Citations |
|---|