EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15NO2 |
| Net Charge | 0 |
| Average Mass | 241.290 |
| Monoisotopic Mass | 241.11028 |
| SMILES | Cc1cccc(Nc2ccccc2C(=O)O)c1C |
| InChI | InChI=1S/C15H15NO2/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18/h3-9,16H,1-2H3,(H,17,18) |
| InChIKey | HYYBABOKPJLUIN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Applications: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antirheumatic drug A drug used to treat rheumatoid arthritis. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. hypoglycemic agent A drug which lowers the blood glucose level. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mefenamic acid (CHEBI:6717) has role analgesic (CHEBI:35480) |
| mefenamic acid (CHEBI:6717) has role antipyretic (CHEBI:35493) |
| mefenamic acid (CHEBI:6717) has role antirheumatic drug (CHEBI:35842) |
| mefenamic acid (CHEBI:6717) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| mefenamic acid (CHEBI:6717) has role environmental contaminant (CHEBI:78298) |
| mefenamic acid (CHEBI:6717) has role hypoglycemic agent (CHEBI:35526) |
| mefenamic acid (CHEBI:6717) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| mefenamic acid (CHEBI:6717) has role xenobiotic (CHEBI:35703) |
| mefenamic acid (CHEBI:6717) is a aminobenzoic acid (CHEBI:22495) |
| mefenamic acid (CHEBI:6717) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 2-[(2,3-dimethylphenyl)amino]benzoic acid |
| INNs | Source |
|---|---|
| acide méfénamique | WHO MedNet |
| ácido mefenámico | WHO MedNet |
| acidum mefenamicum | ChemIDplus |
| mefenamic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| CI-473 | ChemIDplus |
| CN 35355 | ChemIDplus |
| CN-35355 | ChemIDplus |
| N-(2,3-xylyl)-2-aminobenzoic acid | ChemIDplus |
| N-2,3-xylylanthranilic acid | ChemIDplus |
| Gardan | ChEMBL |
| Brand Names | Source |
|---|---|
| Contraflam | ChEMBL |
| Dysman-250 | ChEMBL |
| Dysman-500 | ChEMBL |
| Meflam 250 | ChEMBL |
| Meflam 500 | ChEMBL |
| Mendys | ChEMBL |
| Citations |
|---|