EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O4 |
| Net Charge | 0 |
| Average Mass | 386.532 |
| Monoisotopic Mass | 386.24571 |
| SMILES | [H][C@@]12C[C@H](C)C3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C24H34O4/c1-14-12-18-19(22(4)9-6-17(27)13-21(14)22)7-10-23(5)20(18)8-11-24(23,15(2)25)28-16(3)26/h13-14,18-20H,6-12H2,1-5H3/t14-,18+,19-,20-,22+,23-,24-/m0/s1 |
| InChIKey | PSGAAPLEWMOORI-PEINSRQWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | inhibitor A substance that diminishes the rate of a chemical reaction. progestin A synthetic progestogen. androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| Applications: | synthetic oral contraceptive An oral contraceptive which owes its effectiveness to synthetic preparation. female contraceptive drug A chemical substance or agent with contraceptive activity in females. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. adjuvant Any pharmacological or immunological agent that modifies the effect of other agents such as drugs or vaccines while having few if any direct effects when given by itself. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| medroxyprogesterone acetate (CHEBI:6716) has functional parent medroxyprogesterone (CHEBI:6715) |
| medroxyprogesterone acetate (CHEBI:6716) has role adjuvant (CHEBI:60809) |
| medroxyprogesterone acetate (CHEBI:6716) has role androgen (CHEBI:50113) |
| medroxyprogesterone acetate (CHEBI:6716) has role antineoplastic agent (CHEBI:35610) |
| medroxyprogesterone acetate (CHEBI:6716) has role antioxidant (CHEBI:22586) |
| medroxyprogesterone acetate (CHEBI:6716) has role female contraceptive drug (CHEBI:49324) |
| medroxyprogesterone acetate (CHEBI:6716) has role inhibitor (CHEBI:35222) |
| medroxyprogesterone acetate (CHEBI:6716) has role progestin (CHEBI:59826) |
| medroxyprogesterone acetate (CHEBI:6716) has role synthetic oral contraceptive (CHEBI:49326) |
| medroxyprogesterone acetate (CHEBI:6716) is a 20-oxo steroid (CHEBI:36885) |
| medroxyprogesterone acetate (CHEBI:6716) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| medroxyprogesterone acetate (CHEBI:6716) is a acetate ester (CHEBI:47622) |
| medroxyprogesterone acetate (CHEBI:6716) is a corticosteroid (CHEBI:50858) |
| medroxyprogesterone acetate (CHEBI:6716) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| (6α)-6-methyl-3,20-dioxopregn-4-en-17-yl acetate |
| Synonyms | Source |
|---|---|
| 17-Acetoxy-6α-methylprogesterone | ChemIDplus |
| 17α-Hydroxy-6α-methylprogesterone acetate | ChemIDplus |
| 6-alpha-Methyl-17-alpha-acetoxyprogesterone | KEGG COMPOUND |
| 6-alpha-Methyl-17-alpha-hydroxyprogesterone acetate | KEGG COMPOUND |
| (6α)-17-(Acetyloxy)-6-methylpreg-4-ene-3,20-dione | ChemIDplus |
| 6α-Methyl-17-acetoxy progesterone | ChemIDplus |
| Brand Name | Source |
|---|---|
| Depo-Provera | ChEBI |
| Citations |
|---|