EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O4 |
| Net Charge | 0 |
| Average Mass | 300.354 |
| Monoisotopic Mass | 300.13616 |
| SMILES | C[C@@H]1[C@H](C)[C@H](c2ccc(O)cc2)O[C@H]1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H20O4/c1-10-11(2)18(13-5-8-15(20)16(21)9-13)22-17(10)12-3-6-14(19)7-4-12/h3-11,17-21H,1-2H3/t10-,11+,17+,18+/m0/s1 |
| InChIKey | HKSHEXWQPGOEAT-ZKINDDDQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Larrea tridentata (ncbitaxon:66636) | - | PubMed (12960376) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-3'-hydroxylarreatricin (CHEBI:67154) has role plant metabolite (CHEBI:76924) |
| (+)-3'-hydroxylarreatricin (CHEBI:67154) is a lignan (CHEBI:25036) |
| (+)-3'-hydroxylarreatricin (CHEBI:67154) is a oxolanes (CHEBI:26912) |
| IUPAC Name |
|---|
| 4-[(2R,3S,4R,5R)-5-(4-hydroxyphenyl)-3,4-dimethyltetrahydrofuran-2-yl]benzene-1,2-diol |
| UniProt Name | Source |
|---|---|
| (+)-3'-hydroxylarreatricin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14401 | MetaCyc |
| Citations |
|---|