EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O3 |
| Net Charge | 0 |
| Average Mass | 284.355 |
| Monoisotopic Mass | 284.14124 |
| SMILES | C[C@@H]1[C@H](C)[C@H](c2ccc(O)cc2)O[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C18H20O3/c1-11-12(2)18(14-5-9-16(20)10-6-14)21-17(11)13-3-7-15(19)8-4-13/h3-12,17-20H,1-2H3/t11-,12+,17-,18-/m1/s1 |
| InChIKey | PIBJADPEZQHMQS-FVEFGIFQSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-larreatricin (CHEBI:67153) has role antiviral agent (CHEBI:22587) |
| (+)-larreatricin (CHEBI:67153) has role metabolite (CHEBI:25212) |
| (+)-larreatricin (CHEBI:67153) is a lignan (CHEBI:25036) |
| (+)-larreatricin (CHEBI:67153) is a oxolanes (CHEBI:26912) |
| (+)-larreatricin (CHEBI:67153) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4,4'-[(2R,3R,4S,5R)-3,4-dimethyltetrahydrofuran-2,5-diyl]diphenol |
| Synonyms | Source |
|---|---|
| (2R,3R,4S,5R)-2,5-bis(4-hydroxyphenyl)-3,4-dimethyltetrahydrofuran | ChEBI |
| (2R,3R,4S,5R)-2,5-di(4-hydroxyphenyl)-3,4-dimethyltetrahydrofuran | ChEBI |
| UniProt Name | Source |
|---|---|
| (+)-larreatricin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14400 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9411082 | Reaxys |
| Citations |
|---|