EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H3N3O2 |
| Net Charge | 0 |
| Average Mass | 113.076 |
| Monoisotopic Mass | 113.02253 |
| SMILES | O=[N+]([O-])c1nccn1 |
| InChI | InChI=1S/C3H3N3O2/c7-6(8)3-4-1-2-5-3/h1-2H,(H,4,5) |
| InChIKey | YZEUHQHUFTYLPH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-nitroimidazole (CHEBI:67135) has functional parent 1H-imidazole (CHEBI:16069) |
| 2-nitroimidazole (CHEBI:67135) has role antitubercular agent (CHEBI:33231) |
| 2-nitroimidazole (CHEBI:67135) is a C-nitro compound (CHEBI:35716) |
| 2-nitroimidazole (CHEBI:67135) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| 2-nitro-1H-imidazole |
| Synonyms | Source |
|---|---|
| Azomycin | ChemIDplus |
| nitroimidazole | ChEBI |
| Amicin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-nitroimidazole | UniProt |
| Citations |
|---|