EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6N2O5 |
| Net Charge | 0 |
| Average Mass | 234.167 |
| Monoisotopic Mass | 234.02767 |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2ccccc2c1O |
| InChI | InChI=1S/C10H6N2O5/c13-10-7-4-2-1-3-6(7)8(11(14)15)5-9(10)12(16)17/h1-5,13H |
| InChIKey | FFRBMBIXVSCUFS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dinitro-1-naphthol (CHEBI:67128) has role histological dye (CHEBI:77178) |
| 2,4-dinitro-1-naphthol (CHEBI:67128) is a C-nitro compound (CHEBI:35716) |
| 2,4-dinitro-1-naphthol (CHEBI:67128) is a naphthols (CHEBI:25392) |
| IUPAC Name |
|---|
| 2,4-dinitronaphthalen-1-ol |
| Synonyms | Source |
|---|---|
| 2,4-dinitro-1-hydroxynaphthalene | ChEBI |
| 2,4-dinitronaphthalenol | ChEBI |
| 2,4-dinitro-α-naphthol | ChEBI |
| acid yellow 24 | ChEBI |
| C.I. 10315 | ChEBI |
| Golden yellow | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Martius_yellow | Wikipedia |
| Citations |
|---|